C30H25NO2 — CID 174793768
(6-benzoyl-8,9-diethylcarbazol-3-yl)-phenylmethanone (PubChem CID 174793768) has the molecular formula C30H25NO2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (6-benzoyl-8,9-diethylcarbazol-3-yl)-phenylmethanone.
| Compound Name | (6-benzoyl-8,9-diethylcarbazol-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 174793768 |
| Molecular Formula | C30H25NO2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (6-benzoyl-8,9-diethylcarbazol-3-yl)-phenylmethanone |
| SMILES | CCc1cc(C(=O)c2ccccc2)cc2c3cc(C(=O)c4ccccc4)ccc3n(CC)c12 |
| InChI | InChI=1S/C30H25NO2/c1-3-20-17-24(30(33)22-13-9-6-10-14-22)19-26-25-18-23(29(32)21-11-7-5-8-12-21)15-16-27(25)31(4-2)28(20)26/h5-19H,3-4H2,1-2H3 |
| InChIKey | KZGWPTYAFUBRRY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |