About 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one
5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 174793771) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one |
| PubChem CID | 174793771 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CCC1=C(C)NC(=O)NC1C |
| InChI | InChI=1S/C8H14N2O/c1-4-7-5(2)9-8(11)10-6(7)3/h5H,4H2,1-3H3,(H2,9,10,11) |
| InChIKey | BFVHVVBHRBSKHW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one?
The IUPAC name of 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one (CID 174793771) is 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one.
What is the SMILES notation for 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one?
The canonical SMILES for 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one is CCC1=C(C)NC(=O)NC1C.
What is the InChIKey of 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one?
The InChIKey is BFVHVVBHRBSKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-4-7-5(2)9-8(11)10-6(7)3/h5H,4H2,1-3H3,(H2,9,10,11).
What are the key properties of 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one?
5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one has a molecular weight of 154.21 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one is sourced from PubChem (CID 174793771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).