About N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate
N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate (PubChem CID 174793805) has the molecular formula C16H28N4O2
and a molecular weight of 308.43 g/mol. Its IUPAC name is N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate.
Molecular Properties
| Compound Name | N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate |
| PubChem CID | 174793805 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate |
| SMILES | CCOC(C)=O.CN(C)CCCNc1cc(C2CC2)ncn1 |
| InChI | InChI=1S/C12H20N4.C4H8O2/c1-16(2)7-3-6-13-12-8-11(10-4-5-10)14-9-15-12;1-3-6-4(2)5/h8-10H,3-7H2,1-2H3,(H,13,14,15);3H2,1-2H3 |
| InChIKey | GEYNSAWEJLRWOJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate?
The IUPAC name of N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate (CID 174793805) is N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate.
What is the SMILES notation for N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate?
The canonical SMILES for N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate is CCOC(C)=O.CN(C)CCCNc1cc(C2CC2)ncn1.
What is the InChIKey of N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate?
The InChIKey is GEYNSAWEJLRWOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4.C4H8O2/c1-16(2)7-3-6-13-12-8-11(10-4-5-10)14-9-15-12;1-3-6-4(2)5/h8-10H,3-7H2,1-2H3,(H,13,14,15);3H2,1-2H3.
What are the key properties of N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate?
N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate has a molecular weight of 308.43 g/mol, XLogP of 2.29, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-cyclopropylpyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine;ethyl acetate is sourced from PubChem (CID 174793805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).