About benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea
benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea (PubChem CID 174793875) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea |
| PubChem CID | 174793875 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC(=O)N(C)C.c1ccccc1 |
| InChI | InChI=1S/C6H13N3O2.C6H6/c1-8(2)5(10)7-6(11)9(3)4;1-2-4-6-5-3-1/h1-4H3,(H,7,10,11);1-6H |
| InChIKey | LQWGHXWJQLDZIZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea?
The IUPAC name of benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea (CID 174793875) is benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea.
What is the SMILES notation for benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea?
The canonical SMILES for benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea is CN(C)C(=O)NC(=O)N(C)C.c1ccccc1.
What is the InChIKey of benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea?
The InChIKey is LQWGHXWJQLDZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O2.C6H6/c1-8(2)5(10)7-6(11)9(3)4;1-2-4-6-5-3-1/h1-4H3,(H,7,10,11);1-6H.
What are the key properties of benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea?
benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea has a molecular weight of 237.30 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;3-(dimethylcarbamoyl)-1,1-dimethylurea is sourced from PubChem (CID 174793875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).