About 3-bromo-5-methylpyridine;methyl formate
3-bromo-5-methylpyridine;methyl formate (PubChem CID 174794346) has the molecular formula C8H10BrNO2
and a molecular weight of 232.08 g/mol. Its IUPAC name is 3-bromo-5-methylpyridine;methyl formate.
Molecular Properties
| Compound Name | 3-bromo-5-methylpyridine;methyl formate |
| PubChem CID | 174794346 |
| Molecular Formula | C8H10BrNO2 |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 3-bromo-5-methylpyridine;methyl formate |
| SMILES | COC=O.Cc1cncc(Br)c1 |
| InChI | InChI=1S/C6H6BrN.C2H4O2/c1-5-2-6(7)4-8-3-5;1-4-2-3/h2-4H,1H3;2H,1H3 |
| InChIKey | BTQWPOVRUSSDON-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-methylpyridine;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-methylpyridine;methyl formate?
The IUPAC name of 3-bromo-5-methylpyridine;methyl formate (CID 174794346) is 3-bromo-5-methylpyridine;methyl formate.
What is the SMILES notation for 3-bromo-5-methylpyridine;methyl formate?
The canonical SMILES for 3-bromo-5-methylpyridine;methyl formate is COC=O.Cc1cncc(Br)c1.
What is the InChIKey of 3-bromo-5-methylpyridine;methyl formate?
The InChIKey is BTQWPOVRUSSDON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN.C2H4O2/c1-5-2-6(7)4-8-3-5;1-4-2-3/h2-4H,1H3;2H,1H3.
What are the key properties of 3-bromo-5-methylpyridine;methyl formate?
3-bromo-5-methylpyridine;methyl formate has a molecular weight of 232.08 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-methylpyridine;methyl formate is sourced from PubChem (CID 174794346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).