C30H28N2O3 — CID 174794400
8-(dimethoxymethyl)-1,2,11,12-tetrahydrochrysene;1,8-naphthyridine-3-carbaldehyde (PubChem CID 174794400) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 8-(dimethoxymethyl)-1,2,11,12-tetrahydrochrysene;1,8-naphthyridine-3-carbaldehyde.
| Compound Name | 8-(dimethoxymethyl)-1,2,11,12-tetrahydrochrysene;1,8-naphthyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 174794400 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 8-(dimethoxymethyl)-1,2,11,12-tetrahydrochrysene;1,8-naphthyridine-3-carbaldehyde |
| SMILES | COC(OC)c1ccc2c3c(ccc2c1)C1=C(CCC=C1)CC3.O=Cc1cnc2ncccc2c1 |
| InChI | InChI=1S/C21H22O2.C9H6N2O/c1-22-21(23-2)16-9-10-18-15(13-16)8-12-19-17-6-4-3-5-14(17)7-11-20(18)19;12-6-7-4-8-2-1-3-10-9(8)11-5-7/h4,6,8-10,12-13,21H,3,5,7,11H2,1-2H3;1-6H |
| InChIKey | SJHUAQFGIOQQFC-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|