About 7,8-dihydro-2H-1,8-naphthyridin-3-one
7,8-dihydro-2H-1,8-naphthyridin-3-one (PubChem CID 174794414) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 7,8-dihydro-2H-1,8-naphthyridin-3-one.
Molecular Properties
| Compound Name | 7,8-dihydro-2H-1,8-naphthyridin-3-one |
| PubChem CID | 174794414 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 7,8-dihydro-2H-1,8-naphthyridin-3-one |
| SMILES | O=C1C=C2C=CCNC2=NC1 |
| InChI | InChI=1S/C8H8N2O/c11-7-4-6-2-1-3-9-8(6)10-5-7/h1-2,4H,3,5H2,(H,9,10) |
| InChIKey | VFSZODBRSKQKSW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dihydro-2H-1,8-naphthyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-2H-1,8-naphthyridin-3-one?
The IUPAC name of 7,8-dihydro-2H-1,8-naphthyridin-3-one (CID 174794414) is 7,8-dihydro-2H-1,8-naphthyridin-3-one.
What is the SMILES notation for 7,8-dihydro-2H-1,8-naphthyridin-3-one?
The canonical SMILES for 7,8-dihydro-2H-1,8-naphthyridin-3-one is O=C1C=C2C=CCNC2=NC1.
What is the InChIKey of 7,8-dihydro-2H-1,8-naphthyridin-3-one?
The InChIKey is VFSZODBRSKQKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-7-4-6-2-1-3-9-8(6)10-5-7/h1-2,4H,3,5H2,(H,9,10).
What are the key properties of 7,8-dihydro-2H-1,8-naphthyridin-3-one?
7,8-dihydro-2H-1,8-naphthyridin-3-one has a molecular weight of 148.16 g/mol, XLogP of 0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-2H-1,8-naphthyridin-3-one is sourced from PubChem (CID 174794414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).