About 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium
2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium (PubChem CID 174794836) has the molecular formula C12H8F3N2+
and a molecular weight of 237.20 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium |
| PubChem CID | 174794836 |
| Molecular Formula | C12H8F3N2+ |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium |
| SMILES | FC(F)(F)c1ccc2ccc3[nH+]ccc3c2[nH]1 |
| InChI | InChI=1S/C12H7F3N2/c13-12(14,15)10-4-2-7-1-3-9-8(5-6-16-9)11(7)17-10/h1-6,17H/p+1 |
| InChIKey | UTAJMBXXFWNYIJ-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 29.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium?
The IUPAC name of 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium (CID 174794836) is 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium.
What is the SMILES notation for 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium?
The canonical SMILES for 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium is FC(F)(F)c1ccc2ccc3[nH+]ccc3c2[nH]1.
What is the InChIKey of 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium?
The InChIKey is UTAJMBXXFWNYIJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H7F3N2/c13-12(14,15)10-4-2-7-1-3-9-8(5-6-16-9)11(7)17-10/h1-6,17H/p+1.
What are the key properties of 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium?
2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium has a molecular weight of 237.20 g/mol, XLogP of 3.15, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-1H-pyrrolo[2,3-h]quinolin-7-ium is sourced from PubChem (CID 174794836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).