C26H40O8 — CID 174794942
2-methylprop-2-enoic acid;2-methylpropyl 2,4-dimethyl-3-(5-methyl-2-prop-2-enoyloxyhex-2-enoyl)oxyhex-2-enoate (PubChem CID 174794942) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;2-methylpropyl 2,4-dimethyl-3-(5-methyl-2-prop-2-enoyloxyhex-2-enoyl)oxyhex-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;2-methylpropyl 2,4-dimethyl-3-(5-methyl-2-prop-2-enoyloxyhex-2-enoyl)oxyhex-2-enoate |
|---|---|
| PubChem CID | 174794942 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 2-methylprop-2-enoic acid;2-methylpropyl 2,4-dimethyl-3-(5-methyl-2-prop-2-enoyloxyhex-2-enoyl)oxyhex-2-enoate |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OC(=CCC(C)C)C(=O)OC(=C(C)C(=O)OCC(C)C)C(C)CC |
| InChI | InChI=1S/C22H34O6.C4H6O2/c1-9-16(7)20(17(8)21(24)26-13-15(5)6)28-22(25)18(12-11-14(3)4)27-19(23)10-2;1-3(2)4(5)6/h10,12,14-16H,2,9,11,13H2,1,3-8H3;1H2,2H3,(H,5,6) |
| InChIKey | XBDTWKFHYSGERN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|