About 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine
2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine (PubChem CID 174795917) has the molecular formula C11H27N3
and a molecular weight of 201.36 g/mol. Its IUPAC name is 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine.
Molecular Properties
| Compound Name | 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine |
| PubChem CID | 174795917 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine |
| SMILES | CC1CCC(N)C(C)C1.NCCCN |
| InChI | InChI=1S/C8H17N.C3H10N2/c1-6-3-4-8(9)7(2)5-6;4-2-1-3-5/h6-8H,3-5,9H2,1-2H3;1-5H2 |
| InChIKey | VREXJKPFQKJNBY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine?
The IUPAC name of 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine (CID 174795917) is 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine.
What is the SMILES notation for 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine?
The canonical SMILES for 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine is CC1CCC(N)C(C)C1.NCCCN.
What is the InChIKey of 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine?
The InChIKey is VREXJKPFQKJNBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C3H10N2/c1-6-3-4-8(9)7(2)5-6;4-2-1-3-5/h6-8H,3-5,9H2,1-2H3;1-5H2.
What are the key properties of 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine?
2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine has a molecular weight of 201.36 g/mol, XLogP of 1.06, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylcyclohexan-1-amine;propane-1,3-diamine is sourced from PubChem (CID 174795917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).