About 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane
1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane (PubChem CID 174796338) has the molecular formula C14H18N2O2S
and a molecular weight of 278.38 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane.
Molecular Properties
| Compound Name | 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane |
| PubChem CID | 174796338 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane |
| SMILES | CC(C)c1ccccc1C(C)C.O=C=NSN=C=O |
| InChI | InChI=1S/C12H18.C2N2O2S/c1-9(2)11-7-5-6-8-12(11)10(3)4;5-1-3-7-4-2-6/h5-10H,1-4H3; |
| InChIKey | NMNKQKFIWYQNLN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane?
The IUPAC name of 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane (CID 174796338) is 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane.
What is the SMILES notation for 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane?
The canonical SMILES for 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane is CC(C)c1ccccc1C(C)C.O=C=NSN=C=O.
What is the InChIKey of 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane?
The InChIKey is NMNKQKFIWYQNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C2N2O2S/c1-9(2)11-7-5-6-8-12(11)10(3)4;5-1-3-7-4-2-6/h5-10H,1-4H3;.
What are the key properties of 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane?
1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane has a molecular weight of 278.38 g/mol, XLogP of 4.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-di(propan-2-yl)benzene;isocyanatosulfanylimino(oxo)methane is sourced from PubChem (CID 174796338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).