C25H27Cl2NO3 — CID 174796978
1-[(5S)-5-(chloromethyl)cyclohex-3-en-1-yl]-5-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]pentane-1,5-dione (PubChem CID 174796978) has the molecular formula C25H27Cl2NO3 and a molecular weight of 460.40 g/mol. Its IUPAC name is 1-[(5S)-5-(chloromethyl)cyclohex-3-en-1-yl]-5-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]pentane-1,5-dione.
| Compound Name | 1-[(5S)-5-(chloromethyl)cyclohex-3-en-1-yl]-5-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]pentane-1,5-dione |
|---|---|
| PubChem CID | 174796978 |
| Molecular Formula | C25H27Cl2NO3 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-[(5S)-5-(chloromethyl)cyclohex-3-en-1-yl]-5-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl]pentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1C[C@@H](CCl)c2c1cc(O)c1ccccc21)C1CC=C[C@@H](CCl)C1 |
| InChI | InChI=1S/C25H27Cl2NO3/c26-13-16-5-3-6-17(11-16)22(29)9-4-10-24(31)28-15-18(14-27)25-20-8-2-1-7-19(20)23(30)12-21(25)28/h1-3,5,7-8,12,16-18,30H,4,6,9-11,13-15H2/t16-,17?,18-/m1/s1 |
| InChIKey | IOZFGHFADSZCRE-GVYDCBATSA-N |
| XLogP | 5.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|