About 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium
4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium (PubChem CID 174797016) has the molecular formula C25H32Cl2OZr
and a molecular weight of 510.66 g/mol. Its IUPAC name is 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium.
Molecular Properties
| Compound Name | 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium |
| PubChem CID | 174797016 |
| Molecular Formula | C25H32Cl2OZr |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium |
| SMILES | COc1c(C(C)(C)C)cc(-c2cccc3c2C=C(C)C3)cc1C(C)(C)C.Cl[Zr]Cl |
| InChI | InChI=1S/C25H32O.2ClH.Zr/c1-16-12-17-10-9-11-19(20(17)13-16)18-14-21(24(2,3)4)23(26-8)22(15-18)25(5,6)7;;;/h9-11,13-15H,12H2,1-8H3;2*1H;/q;;;+2/p-2 |
| InChIKey | FCQHHRWNVBUDNM-UHFFFAOYSA-L |
| XLogP | 8.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium?
The IUPAC name of 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium (CID 174797016) is 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium.
What is the SMILES notation for 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium?
The canonical SMILES for 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium is COc1c(C(C)(C)C)cc(-c2cccc3c2C=C(C)C3)cc1C(C)(C)C.Cl[Zr]Cl.
What is the InChIKey of 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium?
The InChIKey is FCQHHRWNVBUDNM-UHFFFAOYSA-L. The full InChI is InChI=1S/C25H32O.2ClH.Zr/c1-16-12-17-10-9-11-19(20(17)13-16)18-14-21(24(2,3)4)23(26-8)22(15-18)25(5,6)7;;;/h9-11,13-15H,12H2,1-8H3;2*1H;/q;;;+2/p-2.
What are the key properties of 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium?
4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium has a molecular weight of 510.66 g/mol, XLogP of 8.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1H-indene;dichlorozirconium is sourced from PubChem (CID 174797016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).