About 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine (PubChem CID 174797021) has the molecular formula C13H19NO4
and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine.
Molecular Properties
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine |
| PubChem CID | 174797021 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine |
| SMILES | C1CCNC1.CC1(C(=O)O)C=CC=C(C(=O)O)C1 |
| InChI | InChI=1S/C9H10O4.C4H9N/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-4-5-3-1/h2-4H,5H2,1H3,(H,10,11)(H,12,13);5H,1-4H2 |
| InChIKey | NUJKWHCWUNCQGS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine?
The IUPAC name of 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine (CID 174797021) is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine.
What is the SMILES notation for 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine?
The canonical SMILES for 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine is C1CCNC1.CC1(C(=O)O)C=CC=C(C(=O)O)C1.
What is the InChIKey of 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine?
The InChIKey is NUJKWHCWUNCQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4.C4H9N/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-4-5-3-1/h2-4H,5H2,1H3,(H,10,11)(H,12,13);5H,1-4H2.
What are the key properties of 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine?
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine has a molecular weight of 253.30 g/mol, XLogP of 1.42, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;pyrrolidine is sourced from PubChem (CID 174797021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).