C20H32O9 — CID 174797134
6-[(3,4,5-trimethoxyphenyl)methoxy]dec-8-ene-1,2,3,4,5-pentol (PubChem CID 174797134) has the molecular formula C20H32O9 and a molecular weight of 416.47 g/mol. Its IUPAC name is 6-[(3,4,5-trimethoxyphenyl)methoxy]dec-8-ene-1,2,3,4,5-pentol.
| Compound Name | 6-[(3,4,5-trimethoxyphenyl)methoxy]dec-8-ene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174797134 |
| Molecular Formula | C20H32O9 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 6-[(3,4,5-trimethoxyphenyl)methoxy]dec-8-ene-1,2,3,4,5-pentol |
| SMILES | CC=CCC(OCc1cc(OC)c(OC)c(OC)c1)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C20H32O9/c1-5-6-7-14(18(24)19(25)17(23)13(22)10-21)29-11-12-8-15(26-2)20(28-4)16(9-12)27-3/h5-6,8-9,13-14,17-19,21-25H,7,10-11H2,1-4H3 |
| InChIKey | XKYPVENXYAXPQW-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|