About cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane
cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane (PubChem CID 174797469) has the molecular formula C16H30Cl4O
and a molecular weight of 380.23 g/mol. Its IUPAC name is cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane.
Molecular Properties
| Compound Name | cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane |
| PubChem CID | 174797469 |
| Molecular Formula | C16H30Cl4O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane |
| SMILES | C1CCC(COCC2CCCC2)C1.CC(Cl)Cl.ClCCCl |
| InChI | InChI=1S/C12H22O.2C2H4Cl2/c1-2-6-11(5-1)9-13-10-12-7-3-4-8-12;1-2(3)4;3-1-2-4/h11-12H,1-10H2;2H,1H3;1-2H2 |
| InChIKey | BIRHPESWTJRPQC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane?
The IUPAC name of cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane (CID 174797469) is cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane.
What is the SMILES notation for cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane?
The canonical SMILES for cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane is C1CCC(COCC2CCCC2)C1.CC(Cl)Cl.ClCCCl.
What is the InChIKey of cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane?
The InChIKey is BIRHPESWTJRPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.2C2H4Cl2/c1-2-6-11(5-1)9-13-10-12-7-3-4-8-12;1-2(3)4;3-1-2-4/h11-12H,1-10H2;2H,1H3;1-2H2.
What are the key properties of cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane?
cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane has a molecular weight of 380.23 g/mol, XLogP of 6.66, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylmethoxymethylcyclopentane;1,1-dichloroethane;1,2-dichloroethane is sourced from PubChem (CID 174797469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).