About ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene
ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene (PubChem CID 174797706) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene.
Molecular Properties
| Compound Name | ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene |
| PubChem CID | 174797706 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene |
| SMILES | C=C(C)OC(=C)C.CCOCC |
| InChI | InChI=1S/C6H10O.C4H10O/c1-5(2)7-6(3)4;1-3-5-4-2/h1,3H2,2,4H3;3-4H2,1-2H3 |
| InChIKey | VKRJLWVQGAFMHU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene?
The IUPAC name of ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene (CID 174797706) is ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene.
What is the SMILES notation for ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene?
The canonical SMILES for ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene is C=C(C)OC(=C)C.CCOCC.
What is the InChIKey of ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene?
The InChIKey is VKRJLWVQGAFMHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C4H10O/c1-5(2)7-6(3)4;1-3-5-4-2/h1,3H2,2,4H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene?
ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene has a molecular weight of 172.27 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;2-prop-1-en-2-yloxyprop-1-ene is sourced from PubChem (CID 174797706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).