C16H20N2O4S2 — CID 17479785
1-N-(2,3-dimethylphenyl)-4-N,4-N-dimethylbenzene-1,4-disulfonamide (PubChem CID 17479785) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-N-(2,3-dimethylphenyl)-4-N,4-N-dimethylbenzene-1,4-disulfonamide.
| Compound Name | 1-N-(2,3-dimethylphenyl)-4-N,4-N-dimethylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 17479785 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-N-(2,3-dimethylphenyl)-4-N,4-N-dimethylbenzene-1,4-disulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(S(=O)(=O)N(C)C)cc2)c1C |
| InChI | InChI=1S/C16H20N2O4S2/c1-12-6-5-7-16(13(12)2)17-23(19,20)14-8-10-15(11-9-14)24(21,22)18(3)4/h5-11,17H,1-4H3 |
| InChIKey | HLCHIJPWAOCCNJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |