C12H7Cl2F3N2O5S2 — CID 174798107
5-[[2,3-dichloro-6-(trifluoromethyl)phenyl]methyl-sulfoamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 174798107) has the molecular formula C12H7Cl2F3N2O5S2 and a molecular weight of 451.23 g/mol. Its IUPAC name is 5-[[2,3-dichloro-6-(trifluoromethyl)phenyl]methyl-sulfoamino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[[2,3-dichloro-6-(trifluoromethyl)phenyl]methyl-sulfoamino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174798107 |
| Molecular Formula | C12H7Cl2F3N2O5S2 |
| Molecular Weight | 451.23 g/mol |
| Exact Mass | 449.91 |
| IUPAC Name | 5-[[2,3-dichloro-6-(trifluoromethyl)phenyl]methyl-sulfoamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1N(Cc1c(C(F)(F)F)ccc(Cl)c1Cl)S(=O)(=O)O |
| InChI | InChI=1S/C12H7Cl2F3N2O5S2/c13-7-2-1-6(12(15,16)17)5(8(7)14)3-19(26(22,23)24)10-9(11(20)21)18-4-25-10/h1-2,4H,3H2,(H,20,21)(H,22,23,24) |
| InChIKey | HDKFDQJXVNSBSK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|