About chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate
chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate (PubChem CID 174798434) has the molecular formula C9H15ClN2O2
and a molecular weight of 218.68 g/mol. Its IUPAC name is chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate.
Molecular Properties
| Compound Name | chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate |
| PubChem CID | 174798434 |
| Molecular Formula | C9H15ClN2O2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate |
| SMILES | CCCl.CN1C=CC=CC1OC(N)=O |
| InChI | InChI=1S/C7H10N2O2.C2H5Cl/c1-9-5-3-2-4-6(9)11-7(8)10;1-2-3/h2-6H,1H3,(H2,8,10);2H2,1H3 |
| InChIKey | BZJJMLXAPZZEOT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate?
The IUPAC name of chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate (CID 174798434) is chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate.
What is the SMILES notation for chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate?
The canonical SMILES for chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate is CCCl.CN1C=CC=CC1OC(N)=O.
What is the InChIKey of chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate?
The InChIKey is BZJJMLXAPZZEOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2.C2H5Cl/c1-9-5-3-2-4-6(9)11-7(8)10;1-2-3/h2-6H,1H3,(H2,8,10);2H2,1H3.
What are the key properties of chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate?
chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate has a molecular weight of 218.68 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethane;(1-methyl-2H-pyridin-2-yl) carbamate is sourced from PubChem (CID 174798434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).