About (1-butylcyclohexyl)phosphane;diphenylphosphane
(1-butylcyclohexyl)phosphane;diphenylphosphane (PubChem CID 174798687) has the molecular formula C22H32P2
and a molecular weight of 358.45 g/mol. Its IUPAC name is (1-butylcyclohexyl)phosphane;diphenylphosphane.
Molecular Properties
| Compound Name | (1-butylcyclohexyl)phosphane;diphenylphosphane |
| PubChem CID | 174798687 |
| Molecular Formula | C22H32P2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (1-butylcyclohexyl)phosphane;diphenylphosphane |
| SMILES | CCCCC1(P)CCCCC1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C10H21P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-7-10(11)8-5-4-6-9-10/h1-10,13H;2-9,11H2,1H3 |
| InChIKey | GSWASIBQBVNXFA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-butylcyclohexyl)phosphane;diphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butylcyclohexyl)phosphane;diphenylphosphane?
The IUPAC name of (1-butylcyclohexyl)phosphane;diphenylphosphane (CID 174798687) is (1-butylcyclohexyl)phosphane;diphenylphosphane.
What is the SMILES notation for (1-butylcyclohexyl)phosphane;diphenylphosphane?
The canonical SMILES for (1-butylcyclohexyl)phosphane;diphenylphosphane is CCCCC1(P)CCCCC1.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of (1-butylcyclohexyl)phosphane;diphenylphosphane?
The InChIKey is GSWASIBQBVNXFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.C10H21P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-7-10(11)8-5-4-6-9-10/h1-10,13H;2-9,11H2,1H3.
What are the key properties of (1-butylcyclohexyl)phosphane;diphenylphosphane?
(1-butylcyclohexyl)phosphane;diphenylphosphane has a molecular weight of 358.45 g/mol, XLogP of 6.07, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butylcyclohexyl)phosphane;diphenylphosphane is sourced from PubChem (CID 174798687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).