About butyl 2,3-dihydroxyhept-6-enoate
butyl 2,3-dihydroxyhept-6-enoate (PubChem CID 174798890) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is butyl 2,3-dihydroxyhept-6-enoate.
Molecular Properties
| Compound Name | butyl 2,3-dihydroxyhept-6-enoate |
| PubChem CID | 174798890 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | butyl 2,3-dihydroxyhept-6-enoate |
| SMILES | C=CCCC(O)C(O)C(=O)OCCCC |
| InChI | InChI=1S/C11H20O4/c1-3-5-7-9(12)10(13)11(14)15-8-6-4-2/h3,9-10,12-13H,1,4-8H2,2H3 |
| InChIKey | AAQPEYDXSNNVTH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butyl 2,3-dihydroxyhept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2,3-dihydroxyhept-6-enoate?
The IUPAC name of butyl 2,3-dihydroxyhept-6-enoate (CID 174798890) is butyl 2,3-dihydroxyhept-6-enoate.
What is the SMILES notation for butyl 2,3-dihydroxyhept-6-enoate?
The canonical SMILES for butyl 2,3-dihydroxyhept-6-enoate is C=CCCC(O)C(O)C(=O)OCCCC.
What is the InChIKey of butyl 2,3-dihydroxyhept-6-enoate?
The InChIKey is AAQPEYDXSNNVTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-3-5-7-9(12)10(13)11(14)15-8-6-4-2/h3,9-10,12-13H,1,4-8H2,2H3.
What are the key properties of butyl 2,3-dihydroxyhept-6-enoate?
butyl 2,3-dihydroxyhept-6-enoate has a molecular weight of 216.28 g/mol, XLogP of 1.02, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2,3-dihydroxyhept-6-enoate is sourced from PubChem (CID 174798890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).