About 2-(3-methylphenyl)-1,3-thiazole-4,5-diol
2-(3-methylphenyl)-1,3-thiazole-4,5-diol (PubChem CID 174799020) has the molecular formula C10H9NO2S
and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-(3-methylphenyl)-1,3-thiazole-4,5-diol.
Molecular Properties
| Compound Name | 2-(3-methylphenyl)-1,3-thiazole-4,5-diol |
| PubChem CID | 174799020 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 2-(3-methylphenyl)-1,3-thiazole-4,5-diol |
| SMILES | Cc1cccc(-c2nc(O)c(O)s2)c1 |
| InChI | InChI=1S/C10H9NO2S/c1-6-3-2-4-7(5-6)9-11-8(12)10(13)14-9/h2-5,12-13H,1H3 |
| InChIKey | OVVBNSDIUUGMSM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methylphenyl)-1,3-thiazole-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylphenyl)-1,3-thiazole-4,5-diol?
The IUPAC name of 2-(3-methylphenyl)-1,3-thiazole-4,5-diol (CID 174799020) is 2-(3-methylphenyl)-1,3-thiazole-4,5-diol.
What is the SMILES notation for 2-(3-methylphenyl)-1,3-thiazole-4,5-diol?
The canonical SMILES for 2-(3-methylphenyl)-1,3-thiazole-4,5-diol is Cc1cccc(-c2nc(O)c(O)s2)c1.
What is the InChIKey of 2-(3-methylphenyl)-1,3-thiazole-4,5-diol?
The InChIKey is OVVBNSDIUUGMSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c1-6-3-2-4-7(5-6)9-11-8(12)10(13)14-9/h2-5,12-13H,1H3.
What are the key properties of 2-(3-methylphenyl)-1,3-thiazole-4,5-diol?
2-(3-methylphenyl)-1,3-thiazole-4,5-diol has a molecular weight of 207.25 g/mol, XLogP of 2.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylphenyl)-1,3-thiazole-4,5-diol is sourced from PubChem (CID 174799020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).