About methoxyethane;3-methylheptane
methoxyethane;3-methylheptane (PubChem CID 174799234) has the molecular formula C11H26O
and a molecular weight of 174.33 g/mol. Its IUPAC name is methoxyethane;3-methylheptane.
Molecular Properties
| Compound Name | methoxyethane;3-methylheptane |
| PubChem CID | 174799234 |
| Molecular Formula | C11H26O |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.20 |
| IUPAC Name | methoxyethane;3-methylheptane |
| SMILES | CCCCC(C)CC.CCOC |
| InChI | InChI=1S/C8H18.C3H8O/c1-4-6-7-8(3)5-2;1-3-4-2/h8H,4-7H2,1-3H3;3H2,1-2H3 |
| InChIKey | VXEJGNWHAPJIQP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methoxyethane;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyethane;3-methylheptane?
The IUPAC name of methoxyethane;3-methylheptane (CID 174799234) is methoxyethane;3-methylheptane.
What is the SMILES notation for methoxyethane;3-methylheptane?
The canonical SMILES for methoxyethane;3-methylheptane is CCCCC(C)CC.CCOC.
What is the InChIKey of methoxyethane;3-methylheptane?
The InChIKey is VXEJGNWHAPJIQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C3H8O/c1-4-6-7-8(3)5-2;1-3-4-2/h8H,4-7H2,1-3H3;3H2,1-2H3.
What are the key properties of methoxyethane;3-methylheptane?
methoxyethane;3-methylheptane has a molecular weight of 174.33 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyethane;3-methylheptane is sourced from PubChem (CID 174799234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).