About 4-methylbenzenethiol;phenol
4-methylbenzenethiol;phenol (PubChem CID 174799239) has the molecular formula C13H14OS
and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-methylbenzenethiol;phenol.
Molecular Properties
| Compound Name | 4-methylbenzenethiol;phenol |
| PubChem CID | 174799239 |
| Molecular Formula | C13H14OS |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 4-methylbenzenethiol;phenol |
| SMILES | Cc1ccc(S)cc1.Oc1ccccc1 |
| InChI | InChI=1S/C7H8S.C6H6O/c1-6-2-4-7(8)5-3-6;7-6-4-2-1-3-5-6/h2-5,8H,1H3;1-5,7H |
| InChIKey | IUWLJUGIFNISGY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenethiol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenethiol;phenol?
The IUPAC name of 4-methylbenzenethiol;phenol (CID 174799239) is 4-methylbenzenethiol;phenol.
What is the SMILES notation for 4-methylbenzenethiol;phenol?
The canonical SMILES for 4-methylbenzenethiol;phenol is Cc1ccc(S)cc1.Oc1ccccc1.
What is the InChIKey of 4-methylbenzenethiol;phenol?
The InChIKey is IUWLJUGIFNISGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S.C6H6O/c1-6-2-4-7(8)5-3-6;7-6-4-2-1-3-5-6/h2-5,8H,1H3;1-5,7H.
What are the key properties of 4-methylbenzenethiol;phenol?
4-methylbenzenethiol;phenol has a molecular weight of 218.32 g/mol, XLogP of 3.68, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenethiol;phenol is sourced from PubChem (CID 174799239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).