About tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one
tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one (PubChem CID 174799735) has the molecular formula C25H31NO3
and a molecular weight of 393.53 g/mol. Its IUPAC name is tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one.
Molecular Properties
| Compound Name | tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one |
| PubChem CID | 174799735 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one |
| SMILES | C=C1CNCC(=Cc2cc(OC)cc(OC)c2)C1=O.CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H17NO3.C10H14/c1-10-8-16-9-12(15(10)17)4-11-5-13(18-2)7-14(6-11)19-3;1-10(2,3)9-7-5-4-6-8-9/h4-7,16H,1,8-9H2,2-3H3;4-8H,1-3H3 |
| InChIKey | DYDQRIOTEFEYJH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one?
The IUPAC name of tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one (CID 174799735) is tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one.
What is the SMILES notation for tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one?
The canonical SMILES for tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one is C=C1CNCC(=Cc2cc(OC)cc(OC)c2)C1=O.CC(C)(C)c1ccccc1.
What is the InChIKey of tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one?
The InChIKey is DYDQRIOTEFEYJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3.C10H14/c1-10-8-16-9-12(15(10)17)4-11-5-13(18-2)7-14(6-11)19-3;1-10(2,3)9-7-5-4-6-8-9/h4-7,16H,1,8-9H2,2-3H3;4-8H,1-3H3.
What are the key properties of tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one?
tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one has a molecular weight of 393.53 g/mol, XLogP of 4.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;3-[(3,5-dimethoxyphenyl)methylidene]-5-methylidenepiperidin-4-one is sourced from PubChem (CID 174799735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).