About 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol
4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol (PubChem CID 174800015) has the molecular formula C19H21NO4
and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol.
Molecular Properties
| Compound Name | 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol |
| PubChem CID | 174800015 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol |
| SMILES | CCNc1ccc(O)c(C)c1O.Oc1ccc2ccc(O)cc2c1 |
| InChI | InChI=1S/C10H8O2.C9H13NO2/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;1-3-10-7-4-5-8(11)6(2)9(7)12/h1-6,11-12H;4-5,10-12H,3H2,1-2H3 |
| InChIKey | ZFUKPWIAECZDMT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol?
The IUPAC name of 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol (CID 174800015) is 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol.
What is the SMILES notation for 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol?
The canonical SMILES for 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol is CCNc1ccc(O)c(C)c1O.Oc1ccc2ccc(O)cc2c1.
What is the InChIKey of 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol?
The InChIKey is ZFUKPWIAECZDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.C9H13NO2/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;1-3-10-7-4-5-8(11)6(2)9(7)12/h1-6,11-12H;4-5,10-12H,3H2,1-2H3.
What are the key properties of 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol?
4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol has a molecular weight of 327.38 g/mol, XLogP of 4.09, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-2-methylbenzene-1,3-diol;naphthalene-2,7-diol is sourced from PubChem (CID 174800015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).