About chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite
chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite (PubChem CID 174800182) has the molecular formula C3H5ClNO3PS
and a molecular weight of 201.57 g/mol. Its IUPAC name is chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite.
Molecular Properties
| Compound Name | chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite |
| PubChem CID | 174800182 |
| Molecular Formula | C3H5ClNO3PS |
| Molecular Weight | 201.57 g/mol |
| Exact Mass | 200.94 |
| IUPAC Name | chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite |
| SMILES | OP(OCl)OC1=NCCS1 |
| InChI | InChI=1S/C3H5ClNO3PS/c4-8-9(6)7-3-5-1-2-10-3/h6H,1-2H2 |
| InChIKey | JZLPAOJTHNFKFG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.57 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite?
The IUPAC name of chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite (CID 174800182) is chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite.
What is the SMILES notation for chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite?
The canonical SMILES for chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite is OP(OCl)OC1=NCCS1.
What is the InChIKey of chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite?
The InChIKey is JZLPAOJTHNFKFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClNO3PS/c4-8-9(6)7-3-5-1-2-10-3/h6H,1-2H2.
What are the key properties of chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite?
chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite has a molecular weight of 201.57 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chloro 4,5-dihydro-1,3-thiazol-2-yl hydrogen phosphite is sourced from PubChem (CID 174800182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).