C30H30ClNO7 — CID 174800769
3-[(1R,2R)-1-[3-(4-chloro-2-hydroxybenzoyl)oxyphenyl]-2-[(dimethylamino)methyl]cyclohexyl]oxycarbonylbenzoic acid (PubChem CID 174800769) has the molecular formula C30H30ClNO7 and a molecular weight of 552.02 g/mol. Its IUPAC name is 3-[(1R,2R)-1-[3-(4-chloro-2-hydroxybenzoyl)oxyphenyl]-2-[(dimethylamino)methyl]cyclohexyl]oxycarbonylbenzoic acid.
| Compound Name | 3-[(1R,2R)-1-[3-(4-chloro-2-hydroxybenzoyl)oxyphenyl]-2-[(dimethylamino)methyl]cyclohexyl]oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 174800769 |
| Molecular Formula | C30H30ClNO7 |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 3-[(1R,2R)-1-[3-(4-chloro-2-hydroxybenzoyl)oxyphenyl]-2-[(dimethylamino)methyl]cyclohexyl]oxycarbonylbenzoic acid |
| SMILES | CN(C)C[C@H]1CCCC[C@]1(OC(=O)c1cccc(C(=O)O)c1)c1cccc(OC(=O)c2ccc(Cl)cc2O)c1 |
| InChI | InChI=1S/C30H30ClNO7/c1-32(2)18-22-9-3-4-14-30(22,39-28(36)20-8-5-7-19(15-20)27(34)35)21-10-6-11-24(16-21)38-29(37)25-13-12-23(31)17-26(25)33/h5-8,10-13,15-17,22,33H,3-4,9,14,18H2,1-2H3,(H,34,35)/t22-,30+/m1/s1 |
| InChIKey | CSXCYAFKBKWQCW-RCRUUEGKSA-N |
| XLogP | 5.77 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|