About phenol;tris(2-methylpropyl)alumane
phenol;tris(2-methylpropyl)alumane (PubChem CID 174801249) has the molecular formula C18H33AlO
and a molecular weight of 292.44 g/mol. Its IUPAC name is phenol;tris(2-methylpropyl)alumane.
Molecular Properties
| Compound Name | phenol;tris(2-methylpropyl)alumane |
| PubChem CID | 174801249 |
| Molecular Formula | C18H33AlO |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | phenol;tris(2-methylpropyl)alumane |
| SMILES | CC(C)C[Al](CC(C)C)CC(C)C.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.3C4H9.Al/c7-6-4-2-1-3-5-6;3*1-4(2)3;/h1-5,7H;3*4H,1H2,2-3H3; |
| InChIKey | JRGKNRIIQSWGEZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenol;tris(2-methylpropyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;tris(2-methylpropyl)alumane?
The IUPAC name of phenol;tris(2-methylpropyl)alumane (CID 174801249) is phenol;tris(2-methylpropyl)alumane.
What is the SMILES notation for phenol;tris(2-methylpropyl)alumane?
The canonical SMILES for phenol;tris(2-methylpropyl)alumane is CC(C)C[Al](CC(C)C)CC(C)C.Oc1ccccc1.
What is the InChIKey of phenol;tris(2-methylpropyl)alumane?
The InChIKey is JRGKNRIIQSWGEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.3C4H9.Al/c7-6-4-2-1-3-5-6;3*1-4(2)3;/h1-5,7H;3*4H,1H2,2-3H3;.
What are the key properties of phenol;tris(2-methylpropyl)alumane?
phenol;tris(2-methylpropyl)alumane has a molecular weight of 292.44 g/mol, XLogP of 5.84, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;tris(2-methylpropyl)alumane is sourced from PubChem (CID 174801249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).