About 1-ethenylnaphthalene;1H-indene
1-ethenylnaphthalene;1H-indene (PubChem CID 174801428) has the molecular formula C21H18
and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-ethenylnaphthalene;1H-indene.
Molecular Properties
| Compound Name | 1-ethenylnaphthalene;1H-indene |
| PubChem CID | 174801428 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-ethenylnaphthalene;1H-indene |
| SMILES | C1=Cc2ccccc2C1.C=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H10.C9H8/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-2-5-9-7-3-6-8(9)4-1/h2-9H,1H2;1-6H,7H2 |
| InChIKey | LZCDFLUCWVLULU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenylnaphthalene;1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylnaphthalene;1H-indene?
The IUPAC name of 1-ethenylnaphthalene;1H-indene (CID 174801428) is 1-ethenylnaphthalene;1H-indene.
What is the SMILES notation for 1-ethenylnaphthalene;1H-indene?
The canonical SMILES for 1-ethenylnaphthalene;1H-indene is C1=Cc2ccccc2C1.C=Cc1cccc2ccccc12.
What is the InChIKey of 1-ethenylnaphthalene;1H-indene?
The InChIKey is LZCDFLUCWVLULU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C9H8/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-2-5-9-7-3-6-8(9)4-1/h2-9H,1H2;1-6H,7H2.
What are the key properties of 1-ethenylnaphthalene;1H-indene?
1-ethenylnaphthalene;1H-indene has a molecular weight of 270.38 g/mol, XLogP of 5.74, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylnaphthalene;1H-indene is sourced from PubChem (CID 174801428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).