About benzyl 3-hydroxyprop-2-ynoate
benzyl 3-hydroxyprop-2-ynoate (PubChem CID 174801498) has the molecular formula C10H8O3
and a molecular weight of 176.17 g/mol. Its IUPAC name is benzyl 3-hydroxyprop-2-ynoate.
Molecular Properties
| Compound Name | benzyl 3-hydroxyprop-2-ynoate |
| PubChem CID | 174801498 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | benzyl 3-hydroxyprop-2-ynoate |
| SMILES | O=C(C#CO)OCc1ccccc1 |
| InChI | InChI=1S/C10H8O3/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5,11H,8H2 |
| InChIKey | HHIPSESQRCNDCW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3-hydroxyprop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-hydroxyprop-2-ynoate?
The IUPAC name of benzyl 3-hydroxyprop-2-ynoate (CID 174801498) is benzyl 3-hydroxyprop-2-ynoate.
What is the SMILES notation for benzyl 3-hydroxyprop-2-ynoate?
The canonical SMILES for benzyl 3-hydroxyprop-2-ynoate is O=C(C#CO)OCc1ccccc1.
What is the InChIKey of benzyl 3-hydroxyprop-2-ynoate?
The InChIKey is HHIPSESQRCNDCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5,11H,8H2.
What are the key properties of benzyl 3-hydroxyprop-2-ynoate?
benzyl 3-hydroxyprop-2-ynoate has a molecular weight of 176.17 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-hydroxyprop-2-ynoate is sourced from PubChem (CID 174801498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).