About ethylbenzene;pyridin-2-ylmethanimine
ethylbenzene;pyridin-2-ylmethanimine (PubChem CID 174801514) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is ethylbenzene;pyridin-2-ylmethanimine.
Molecular Properties
| Compound Name | ethylbenzene;pyridin-2-ylmethanimine |
| PubChem CID | 174801514 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | ethylbenzene;pyridin-2-ylmethanimine |
| SMILES | CCc1ccccc1.[H]/N=C/c1ccccn1 |
| InChI | InChI=1S/C8H10.C6H6N2/c1-2-8-6-4-3-5-7-8;7-5-6-3-1-2-4-8-6/h3-7H,2H2,1H3;1-5,7H/b;7-5+ |
| InChIKey | HWBUFTIUUXASDH-QIHXQYKCSA-N |
| XLogP | 3.33 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethylbenzene;pyridin-2-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;pyridin-2-ylmethanimine?
The IUPAC name of ethylbenzene;pyridin-2-ylmethanimine (CID 174801514) is ethylbenzene;pyridin-2-ylmethanimine.
What is the SMILES notation for ethylbenzene;pyridin-2-ylmethanimine?
The canonical SMILES for ethylbenzene;pyridin-2-ylmethanimine is CCc1ccccc1.[H]/N=C/c1ccccn1.
What is the InChIKey of ethylbenzene;pyridin-2-ylmethanimine?
The InChIKey is HWBUFTIUUXASDH-QIHXQYKCSA-N. The full InChI is InChI=1S/C8H10.C6H6N2/c1-2-8-6-4-3-5-7-8;7-5-6-3-1-2-4-8-6/h3-7H,2H2,1H3;1-5,7H/b;7-5+.
What are the key properties of ethylbenzene;pyridin-2-ylmethanimine?
ethylbenzene;pyridin-2-ylmethanimine has a molecular weight of 212.30 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;pyridin-2-ylmethanimine is sourced from PubChem (CID 174801514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).