C17H13Cl2F3N2O2 — CID 174801615
4-chloro-2-[[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1,3-dihydropyrrolo[3,4-c]pyridine-1-carbaldehyde (PubChem CID 174801615) has the molecular formula C17H13Cl2F3N2O2 and a molecular weight of 405.20 g/mol. Its IUPAC name is 4-chloro-2-[[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1,3-dihydropyrrolo[3,4-c]pyridine-1-carbaldehyde.
| Compound Name | 4-chloro-2-[[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1,3-dihydropyrrolo[3,4-c]pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 174801615 |
| Molecular Formula | C17H13Cl2F3N2O2 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 4-chloro-2-[[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1,3-dihydropyrrolo[3,4-c]pyridine-1-carbaldehyde |
| SMILES | O=CC1c2ccnc(Cl)c2CN1Cc1ccc(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2F3N2O2/c18-13-5-10(1-2-15(13)26-9-17(20,21)22)6-24-7-12-11(14(24)8-25)3-4-23-16(12)19/h1-5,8,14H,6-7,9H2 |
| InChIKey | CYWPMHHXHNLPLO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|