About 2-bromopenta-2,3-dienenitrile
2-bromopenta-2,3-dienenitrile (PubChem CID 174802080) has the molecular formula C5H4BrN
and a molecular weight of 158.00 g/mol. Its IUPAC name is 2-bromopenta-2,3-dienenitrile.
Molecular Properties
| Compound Name | 2-bromopenta-2,3-dienenitrile |
| PubChem CID | 174802080 |
| Molecular Formula | C5H4BrN |
| Molecular Weight | 158.00 g/mol |
| Exact Mass | 156.95 |
| IUPAC Name | 2-bromopenta-2,3-dienenitrile |
| SMILES | CC=C=C(Br)C#N |
| InChI | InChI=1S/C5H4BrN/c1-2-3-5(6)4-7/h2H,1H3 |
| InChIKey | FBCCJQTUCHMXLR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.00 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopenta-2,3-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopenta-2,3-dienenitrile?
The IUPAC name of 2-bromopenta-2,3-dienenitrile (CID 174802080) is 2-bromopenta-2,3-dienenitrile.
What is the SMILES notation for 2-bromopenta-2,3-dienenitrile?
The canonical SMILES for 2-bromopenta-2,3-dienenitrile is CC=C=C(Br)C#N.
What is the InChIKey of 2-bromopenta-2,3-dienenitrile?
The InChIKey is FBCCJQTUCHMXLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrN/c1-2-3-5(6)4-7/h2H,1H3.
What are the key properties of 2-bromopenta-2,3-dienenitrile?
2-bromopenta-2,3-dienenitrile has a molecular weight of 158.00 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopenta-2,3-dienenitrile is sourced from PubChem (CID 174802080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).