About 1-(3H-1,2-benzodioxol-3-yl)piperidine
1-(3H-1,2-benzodioxol-3-yl)piperidine (PubChem CID 174802317) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(3H-1,2-benzodioxol-3-yl)piperidine.
Molecular Properties
| Compound Name | 1-(3H-1,2-benzodioxol-3-yl)piperidine |
| PubChem CID | 174802317 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-(3H-1,2-benzodioxol-3-yl)piperidine |
| SMILES | c1ccc2c(c1)OOC2N1CCCCC1 |
| InChI | InChI=1S/C12H15NO2/c1-4-8-13(9-5-1)12-10-6-2-3-7-11(10)14-15-12/h2-3,6-7,12H,1,4-5,8-9H2 |
| InChIKey | GYZMGECRDHTXIX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3H-1,2-benzodioxol-3-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3H-1,2-benzodioxol-3-yl)piperidine?
The IUPAC name of 1-(3H-1,2-benzodioxol-3-yl)piperidine (CID 174802317) is 1-(3H-1,2-benzodioxol-3-yl)piperidine.
What is the SMILES notation for 1-(3H-1,2-benzodioxol-3-yl)piperidine?
The canonical SMILES for 1-(3H-1,2-benzodioxol-3-yl)piperidine is c1ccc2c(c1)OOC2N1CCCCC1.
What is the InChIKey of 1-(3H-1,2-benzodioxol-3-yl)piperidine?
The InChIKey is GYZMGECRDHTXIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-4-8-13(9-5-1)12-10-6-2-3-7-11(10)14-15-12/h2-3,6-7,12H,1,4-5,8-9H2.
What are the key properties of 1-(3H-1,2-benzodioxol-3-yl)piperidine?
1-(3H-1,2-benzodioxol-3-yl)piperidine has a molecular weight of 205.26 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3H-1,2-benzodioxol-3-yl)piperidine is sourced from PubChem (CID 174802317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).