C10H19NaO7S — CID 174802925
sodium;4-hexoxy-4-oxo-3-sulfobutanoic acid;hydride (PubChem CID 174802925) has the molecular formula C10H19NaO7S and a molecular weight of 306.31 g/mol. Its IUPAC name is sodium;4-hexoxy-4-oxo-3-sulfobutanoic acid;hydride.
| Compound Name | sodium;4-hexoxy-4-oxo-3-sulfobutanoic acid;hydride |
|---|---|
| PubChem CID | 174802925 |
| Molecular Formula | C10H19NaO7S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | sodium;4-hexoxy-4-oxo-3-sulfobutanoic acid;hydride |
| SMILES | CCCCCCOC(=O)C(CC(=O)O)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C10H18O7S.Na.H/c1-2-3-4-5-6-17-10(13)8(7-9(11)12)18(14,15)16;;/h8H,2-7H2,1H3,(H,11,12)(H,14,15,16);;/q;+1;-1 |
| InChIKey | UJCRDQWFDGHUSJ-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|