About azane;1-O-methyl 4-O-prop-2-enoyl butanedioate
azane;1-O-methyl 4-O-prop-2-enoyl butanedioate (PubChem CID 174803065) has the molecular formula C8H13NO5
and a molecular weight of 203.19 g/mol. Its IUPAC name is azane;1-O-methyl 4-O-prop-2-enoyl butanedioate.
Molecular Properties
| Compound Name | azane;1-O-methyl 4-O-prop-2-enoyl butanedioate |
| PubChem CID | 174803065 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | azane;1-O-methyl 4-O-prop-2-enoyl butanedioate |
| SMILES | C=CC(=O)OC(=O)CCC(=O)OC.N |
| InChI | InChI=1S/C8H10O5.H3N/c1-3-6(9)13-8(11)5-4-7(10)12-2;/h3H,1,4-5H2,2H3;1H3 |
| InChIKey | PIMRBURTCHJJMX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;1-O-methyl 4-O-prop-2-enoyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-O-methyl 4-O-prop-2-enoyl butanedioate?
The IUPAC name of azane;1-O-methyl 4-O-prop-2-enoyl butanedioate (CID 174803065) is azane;1-O-methyl 4-O-prop-2-enoyl butanedioate.
What is the SMILES notation for azane;1-O-methyl 4-O-prop-2-enoyl butanedioate?
The canonical SMILES for azane;1-O-methyl 4-O-prop-2-enoyl butanedioate is C=CC(=O)OC(=O)CCC(=O)OC.N.
What is the InChIKey of azane;1-O-methyl 4-O-prop-2-enoyl butanedioate?
The InChIKey is PIMRBURTCHJJMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5.H3N/c1-3-6(9)13-8(11)5-4-7(10)12-2;/h3H,1,4-5H2,2H3;1H3.
What are the key properties of azane;1-O-methyl 4-O-prop-2-enoyl butanedioate?
azane;1-O-methyl 4-O-prop-2-enoyl butanedioate has a molecular weight of 203.19 g/mol, XLogP of 0.36, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-O-methyl 4-O-prop-2-enoyl butanedioate is sourced from PubChem (CID 174803065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).