C12H18AgO — CID 174803720
2,6-di(propan-2-yl)phenol;silver (PubChem CID 174803720) has the molecular formula C12H18AgO and a molecular weight of 286.14 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)phenol;silver.
| Compound Name | 2,6-di(propan-2-yl)phenol;silver |
|---|---|
| PubChem CID | 174803720 |
| Molecular Formula | C12H18AgO |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2,6-di(propan-2-yl)phenol;silver |
| SMILES | CC(C)c1cccc(C(C)C)c1O.[Ag] |
| InChI | InChI=1S/C12H18O.Ag/c1-8(2)10-6-5-7-11(9(3)4)12(10)13;/h5-9,13H,1-4H3; |
| InChIKey | PTBVYSYAUULSQD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |