About 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde
1-methylpiperazine;4-methylpiperazine-1-carbaldehyde (PubChem CID 174803758) has the molecular formula C11H24N4O
and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde.
Molecular Properties
| Compound Name | 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde |
| PubChem CID | 174803758 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde |
| SMILES | CN1CCN(C=O)CC1.CN1CCNCC1 |
| InChI | InChI=1S/C6H12N2O.C5H12N2/c1-7-2-4-8(6-9)5-3-7;1-7-4-2-6-3-5-7/h6H,2-5H2,1H3;6H,2-5H2,1H3 |
| InChIKey | WVEKBISCPFMASQ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde?
The IUPAC name of 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde (CID 174803758) is 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde.
What is the SMILES notation for 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde?
The canonical SMILES for 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde is CN1CCN(C=O)CC1.CN1CCNCC1.
What is the InChIKey of 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde?
The InChIKey is WVEKBISCPFMASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C5H12N2/c1-7-2-4-8(6-9)5-3-7;1-7-4-2-6-3-5-7/h6H,2-5H2,1H3;6H,2-5H2,1H3.
What are the key properties of 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde?
1-methylpiperazine;4-methylpiperazine-1-carbaldehyde has a molecular weight of 228.34 g/mol, XLogP of -1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperazine;4-methylpiperazine-1-carbaldehyde is sourced from PubChem (CID 174803758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).