About 1-cyclohexylpyrrole-2,5-dione;1H-indene
1-cyclohexylpyrrole-2,5-dione;1H-indene (PubChem CID 174803812) has the molecular formula C19H21NO2
and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-cyclohexylpyrrole-2,5-dione;1H-indene.
Molecular Properties
| Compound Name | 1-cyclohexylpyrrole-2,5-dione;1H-indene |
| PubChem CID | 174803812 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-cyclohexylpyrrole-2,5-dione;1H-indene |
| SMILES | C1=Cc2ccccc2C1.O=C1C=CC(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C10H13NO2.C9H8/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8;1-2-5-9-7-3-6-8(9)4-1/h6-8H,1-5H2;1-6H,7H2 |
| InChIKey | BNCSDMUIDAPHET-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylpyrrole-2,5-dione;1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylpyrrole-2,5-dione;1H-indene?
The IUPAC name of 1-cyclohexylpyrrole-2,5-dione;1H-indene (CID 174803812) is 1-cyclohexylpyrrole-2,5-dione;1H-indene.
What is the SMILES notation for 1-cyclohexylpyrrole-2,5-dione;1H-indene?
The canonical SMILES for 1-cyclohexylpyrrole-2,5-dione;1H-indene is C1=Cc2ccccc2C1.O=C1C=CC(=O)N1C1CCCCC1.
What is the InChIKey of 1-cyclohexylpyrrole-2,5-dione;1H-indene?
The InChIKey is BNCSDMUIDAPHET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C9H8/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8;1-2-5-9-7-3-6-8(9)4-1/h6-8H,1-5H2;1-6H,7H2.
What are the key properties of 1-cyclohexylpyrrole-2,5-dione;1H-indene?
1-cyclohexylpyrrole-2,5-dione;1H-indene has a molecular weight of 295.38 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylpyrrole-2,5-dione;1H-indene is sourced from PubChem (CID 174803812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).