About 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane
3-ethenyl-1,1,2-triethoxy-2-ethylsilinane (PubChem CID 174804142) has the molecular formula C15H30O3Si
and a molecular weight of 286.49 g/mol. Its IUPAC name is 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane.
Molecular Properties
| Compound Name | 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane |
| PubChem CID | 174804142 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane |
| SMILES | C=CC1CCC[Si](OCC)(OCC)C1(CC)OCC |
| InChI | InChI=1S/C15H30O3Si/c1-6-14-12-11-13-19(17-9-4,18-10-5)15(14,7-2)16-8-3/h6,14H,1,7-13H2,2-5H3 |
| InChIKey | YBLJBOSCBXTJIV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane?
The IUPAC name of 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane (CID 174804142) is 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane.
What is the SMILES notation for 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane?
The canonical SMILES for 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane is C=CC1CCC[Si](OCC)(OCC)C1(CC)OCC.
What is the InChIKey of 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane?
The InChIKey is YBLJBOSCBXTJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3Si/c1-6-14-12-11-13-19(17-9-4,18-10-5)15(14,7-2)16-8-3/h6,14H,1,7-13H2,2-5H3.
What are the key properties of 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane?
3-ethenyl-1,1,2-triethoxy-2-ethylsilinane has a molecular weight of 286.49 g/mol, XLogP of 3.82, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1,1,2-triethoxy-2-ethylsilinane is sourced from PubChem (CID 174804142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).