About (3-aminophenyl)methanol;phenol
(3-aminophenyl)methanol;phenol (PubChem CID 174804454) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is (3-aminophenyl)methanol;phenol.
Molecular Properties
| Compound Name | (3-aminophenyl)methanol;phenol |
| PubChem CID | 174804454 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (3-aminophenyl)methanol;phenol |
| SMILES | Nc1cccc(CO)c1.Oc1ccccc1 |
| InChI | InChI=1S/C7H9NO.C6H6O/c8-7-3-1-2-6(4-7)5-9;7-6-4-2-1-3-5-6/h1-4,9H,5,8H2;1-5,7H |
| InChIKey | YQOVARGZIWOLQZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-aminophenyl)methanol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminophenyl)methanol;phenol?
The IUPAC name of (3-aminophenyl)methanol;phenol (CID 174804454) is (3-aminophenyl)methanol;phenol.
What is the SMILES notation for (3-aminophenyl)methanol;phenol?
The canonical SMILES for (3-aminophenyl)methanol;phenol is Nc1cccc(CO)c1.Oc1ccccc1.
What is the InChIKey of (3-aminophenyl)methanol;phenol?
The InChIKey is YQOVARGZIWOLQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.C6H6O/c8-7-3-1-2-6(4-7)5-9;7-6-4-2-1-3-5-6/h1-4,9H,5,8H2;1-5,7H.
What are the key properties of (3-aminophenyl)methanol;phenol?
(3-aminophenyl)methanol;phenol has a molecular weight of 217.27 g/mol, XLogP of 2.15, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminophenyl)methanol;phenol is sourced from PubChem (CID 174804454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).