About 4-triphenylstannylphenol
4-triphenylstannylphenol (PubChem CID 174804876) has the molecular formula C24H20OSn
and a molecular weight of 443.13 g/mol. Its IUPAC name is 4-triphenylstannylphenol.
Molecular Properties
| Compound Name | 4-triphenylstannylphenol |
| PubChem CID | 174804876 |
| Molecular Formula | C24H20OSn |
| Molecular Weight | 443.13 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 4-triphenylstannylphenol |
| SMILES | Oc1ccc([Sn](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C6H5O.3C6H5.Sn/c7-6-4-2-1-3-5-6;3*1-2-4-6-5-3-1;/h2-5,7H;3*1-5H; |
| InChIKey | BRULDXYMGBMBOT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.13 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-triphenylstannylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-triphenylstannylphenol?
The IUPAC name of 4-triphenylstannylphenol (CID 174804876) is 4-triphenylstannylphenol.
What is the SMILES notation for 4-triphenylstannylphenol?
The canonical SMILES for 4-triphenylstannylphenol is Oc1ccc([Sn](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-triphenylstannylphenol?
The InChIKey is BRULDXYMGBMBOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5O.3C6H5.Sn/c7-6-4-2-1-3-5-6;3*1-2-4-6-5-3-1;/h2-5,7H;3*1-5H;.
What are the key properties of 4-triphenylstannylphenol?
4-triphenylstannylphenol has a molecular weight of 443.13 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-triphenylstannylphenol is sourced from PubChem (CID 174804876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).