About 1,4-diiodobenzene;phenol;sulfane
1,4-diiodobenzene;phenol;sulfane (PubChem CID 174804949) has the molecular formula C12H12I2OS
and a molecular weight of 458.10 g/mol. Its IUPAC name is 1,4-diiodobenzene;phenol;sulfane.
Molecular Properties
| Compound Name | 1,4-diiodobenzene;phenol;sulfane |
| PubChem CID | 174804949 |
| Molecular Formula | C12H12I2OS |
| Molecular Weight | 458.10 g/mol |
| Exact Mass | 457.87 |
| IUPAC Name | 1,4-diiodobenzene;phenol;sulfane |
| SMILES | Ic1ccc(I)cc1.Oc1ccccc1.S |
| InChI | InChI=1S/C6H4I2.C6H6O.H2S/c7-5-1-2-6(8)4-3-5;7-6-4-2-1-3-5-6;/h1-4H;1-5,7H;1H2 |
| InChIKey | UTXZVCPYWPLJKI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.10 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diiodobenzene;phenol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diiodobenzene;phenol;sulfane?
The IUPAC name of 1,4-diiodobenzene;phenol;sulfane (CID 174804949) is 1,4-diiodobenzene;phenol;sulfane.
What is the SMILES notation for 1,4-diiodobenzene;phenol;sulfane?
The canonical SMILES for 1,4-diiodobenzene;phenol;sulfane is Ic1ccc(I)cc1.Oc1ccccc1.S.
What is the InChIKey of 1,4-diiodobenzene;phenol;sulfane?
The InChIKey is UTXZVCPYWPLJKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4I2.C6H6O.H2S/c7-5-1-2-6(8)4-3-5;7-6-4-2-1-3-5-6;/h1-4H;1-5,7H;1H2.
What are the key properties of 1,4-diiodobenzene;phenol;sulfane?
1,4-diiodobenzene;phenol;sulfane has a molecular weight of 458.10 g/mol, XLogP of 4.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diiodobenzene;phenol;sulfane is sourced from PubChem (CID 174804949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).