C42H56O7 — CID 174805086
2,3-dimethylphenol;2,4-dimethylphenol;2,5-dimethylphenol;2,6-dimethylphenol;3,4-dimethylphenol;ethane-1,2-diol (PubChem CID 174805086) has the molecular formula C42H56O7 and a molecular weight of 672.90 g/mol. Its IUPAC name is 2,3-dimethylphenol;2,4-dimethylphenol;2,5-dimethylphenol;2,6-dimethylphenol;3,4-dimethylphenol;ethane-1,2-diol.
| Compound Name | 2,3-dimethylphenol;2,4-dimethylphenol;2,5-dimethylphenol;2,6-dimethylphenol;3,4-dimethylphenol;ethane-1,2-diol |
|---|---|
| PubChem CID | 174805086 |
| Molecular Formula | C42H56O7 |
| Molecular Weight | 672.90 g/mol |
| Exact Mass | 672.40 |
| IUPAC Name | 2,3-dimethylphenol;2,4-dimethylphenol;2,5-dimethylphenol;2,6-dimethylphenol;3,4-dimethylphenol;ethane-1,2-diol |
| SMILES | Cc1ccc(C)c(O)c1.Cc1ccc(O)c(C)c1.Cc1ccc(O)cc1C.Cc1cccc(C)c1O.Cc1cccc(O)c1C.OCCO |
| InChI | InChI=1S/5C8H10O.C2H6O2/c1-6-3-4-8(9)5-7(6)2;1-6-3-4-8(9)7(2)5-6;1-6-3-4-7(2)8(9)5-6;1-6-4-3-5-8(9)7(6)2;1-6-4-3-5-7(2)8(6)9;3-1-2-4/h5*3-5,9H,1-2H3;3-4H,1-2H2 |
| InChIKey | SRAYFWQHTXFTLG-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.90 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |