potassium;hydride;2-phenoxypropanoic acid

C9H11KO3 — CID 174805355

IUPACpotassium;hydride;2-phenoxypropanoic acid
SMILESCC(Oc1ccccc1)C(=O)O.[H-].[K+]
InChIInChI=1S/C9H10O3.K.H/c1-7(9(10)11)12-8-5-3-2-4-6-8;;/h2-7H,1H3,(H,10,11);;/q;+1;-1
InChIKeyGUXZOZQQISLNER-UHFFFAOYSA-N
MW206.28 g/mol
LogP-1.35
Rot. Bonds3

About potassium;hydride;2-phenoxypropanoic acid

potassium;hydride;2-phenoxypropanoic acid (PubChem CID 174805355) has the molecular formula C9H11KO3 and a molecular weight of 206.28 g/mol. Its IUPAC name is potassium;hydride;2-phenoxypropanoic acid.

Molecular Properties

Compound Namepotassium;hydride;2-phenoxypropanoic acid
PubChem CID174805355
Molecular FormulaC9H11KO3
Molecular Weight206.28 g/mol
Exact Mass206.03
IUPAC Namepotassium;hydride;2-phenoxypropanoic acid
SMILESCC(Oc1ccccc1)C(=O)O.[H-].[K+]
InChIInChI=1S/C9H10O3.K.H/c1-7(9(10)11)12-8-5-3-2-4-6-8;;/h2-7H,1H3,(H,10,11);;/q;+1;-1
InChIKeyGUXZOZQQISLNER-UHFFFAOYSA-N
XLogP-1.35
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.28
LogP ≤ 5-1.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze potassium;hydride;2-phenoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium;hydride;2-phenoxypropanoic acid?
The IUPAC name of potassium;hydride;2-phenoxypropanoic acid (CID 174805355) is potassium;hydride;2-phenoxypropanoic acid.
What is the SMILES notation for potassium;hydride;2-phenoxypropanoic acid?
The canonical SMILES for potassium;hydride;2-phenoxypropanoic acid is CC(Oc1ccccc1)C(=O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;2-phenoxypropanoic acid?
The InChIKey is GUXZOZQQISLNER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.K.H/c1-7(9(10)11)12-8-5-3-2-4-6-8;;/h2-7H,1H3,(H,10,11);;/q;+1;-1.
What are the key properties of potassium;hydride;2-phenoxypropanoic acid?
potassium;hydride;2-phenoxypropanoic acid has a molecular weight of 206.28 g/mol, XLogP of -1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-phenoxypropanoic acid is sourced from PubChem (CID 174805355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).