C11H23NO4 — CID 174805549
tert-butyl hydrogen carbonate;(2-methylpyrrolidin-2-yl)methanol (PubChem CID 174805549) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is tert-butyl hydrogen carbonate;(2-methylpyrrolidin-2-yl)methanol.
| Compound Name | tert-butyl hydrogen carbonate;(2-methylpyrrolidin-2-yl)methanol |
|---|---|
| PubChem CID | 174805549 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | tert-butyl hydrogen carbonate;(2-methylpyrrolidin-2-yl)methanol |
| SMILES | CC(C)(C)OC(=O)O.CC1(CO)CCCN1 |
| InChI | InChI=1S/C6H13NO.C5H10O3/c1-6(5-8)3-2-4-7-6;1-5(2,3)8-4(6)7/h7-8H,2-5H2,1H3;1-3H3,(H,6,7) |
| InChIKey | FMNBHLBZWGECTL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |