C32H36N4O5 — CID 174806150
4-butyl-1-(4-hydroxyphenyl)-2-phenylpyrazolidine-3,5-dione;4-butyl-1-phenylpyrazolidine-3,5-dione (PubChem CID 174806150) has the molecular formula C32H36N4O5 and a molecular weight of 556.66 g/mol. Its IUPAC name is 4-butyl-1-(4-hydroxyphenyl)-2-phenylpyrazolidine-3,5-dione;4-butyl-1-phenylpyrazolidine-3,5-dione.
| Compound Name | 4-butyl-1-(4-hydroxyphenyl)-2-phenylpyrazolidine-3,5-dione;4-butyl-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 174806150 |
| Molecular Formula | C32H36N4O5 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 4-butyl-1-(4-hydroxyphenyl)-2-phenylpyrazolidine-3,5-dione;4-butyl-1-phenylpyrazolidine-3,5-dione |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccc(O)cc2)C1=O.CCCCC1C(=O)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N2O3.C13H16N2O2/c1-2-3-9-17-18(23)20(14-7-5-4-6-8-14)21(19(17)24)15-10-12-16(22)13-11-15;1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10/h4-8,10-13,17,22H,2-3,9H2,1H3;4-8,11H,2-3,9H2,1H3,(H,14,16) |
| InChIKey | MMVXFTDWMRUVBF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|