C19H18S — CID 174806842
8-methylsulfanyl-1,2,11,12-tetrahydrochrysene (PubChem CID 174806842) has the molecular formula C19H18S and a molecular weight of 278.42 g/mol. Its IUPAC name is 8-methylsulfanyl-1,2,11,12-tetrahydrochrysene.
| Compound Name | 8-methylsulfanyl-1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174806842 |
| Molecular Formula | C19H18S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 8-methylsulfanyl-1,2,11,12-tetrahydrochrysene |
| SMILES | CSc1ccc2c3c(ccc2c1)C1=C(CCC=C1)CC3 |
| InChI | InChI=1S/C19H18S/c1-20-15-8-11-17-14(12-15)7-10-18-16-5-3-2-4-13(16)6-9-19(17)18/h3,5,7-8,10-12H,2,4,6,9H2,1H3 |
| InChIKey | BRLPFMBLLXRJHB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |